C18H27NOSi — CID 171058482
1-(1-butyl-3-methylindol-2-yl)ethenoxy-trimethylsilane (PubChem CID 171058482) has the molecular formula C18H27NOSi and a molecular weight of 301.51 g/mol. Its IUPAC name is 1-(1-butyl-3-methylindol-2-yl)ethenoxy-trimethylsilane.
| Compound Name | 1-(1-butyl-3-methylindol-2-yl)ethenoxy-trimethylsilane |
|---|---|
| PubChem CID | 171058482 |
| Molecular Formula | C18H27NOSi |
| Molecular Weight | 301.51 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 1-(1-butyl-3-methylindol-2-yl)ethenoxy-trimethylsilane |
| SMILES | C=C(O[Si](C)(C)C)c1c(C)c2ccccc2n1CCCC |
| InChI | InChI=1S/C18H27NOSi/c1-7-8-13-19-17-12-10-9-11-16(17)14(2)18(19)15(3)20-21(4,5)6/h9-12H,3,7-8,13H2,1-2,4-6H3 |
| InChIKey | KLIKGBYWQUYBPR-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.51 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|