C24H19F3O — CID 171060339
1-naphthalen-2-yl-6-phenyl-4-(2,2,2-trifluoroethyl)hex-5-yn-1-one (PubChem CID 171060339) has the molecular formula C24H19F3O and a molecular weight of 380.41 g/mol. Its IUPAC name is 1-naphthalen-2-yl-6-phenyl-4-(2,2,2-trifluoroethyl)hex-5-yn-1-one.
| Compound Name | 1-naphthalen-2-yl-6-phenyl-4-(2,2,2-trifluoroethyl)hex-5-yn-1-one |
|---|---|
| PubChem CID | 171060339 |
| Molecular Formula | C24H19F3O |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 1-naphthalen-2-yl-6-phenyl-4-(2,2,2-trifluoroethyl)hex-5-yn-1-one |
| SMILES | O=C(CCC(C#Cc1ccccc1)CC(F)(F)F)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H19F3O/c25-24(26,27)17-19(11-10-18-6-2-1-3-7-18)12-15-23(28)22-14-13-20-8-4-5-9-21(20)16-22/h1-9,13-14,16,19H,12,15,17H2 |
| InChIKey | YOPPYFGIWNHMEM-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|