C21H19F3O — CID 171060378
6-(3-methylphenyl)-1-phenyl-4-(2,2,2-trifluoroethyl)hex-5-yn-1-one (PubChem CID 171060378) has the molecular formula C21H19F3O and a molecular weight of 344.38 g/mol. Its IUPAC name is 6-(3-methylphenyl)-1-phenyl-4-(2,2,2-trifluoroethyl)hex-5-yn-1-one.
| Compound Name | 6-(3-methylphenyl)-1-phenyl-4-(2,2,2-trifluoroethyl)hex-5-yn-1-one |
|---|---|
| PubChem CID | 171060378 |
| Molecular Formula | C21H19F3O |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 6-(3-methylphenyl)-1-phenyl-4-(2,2,2-trifluoroethyl)hex-5-yn-1-one |
| SMILES | Cc1cccc(C#CC(CCC(=O)c2ccccc2)CC(F)(F)F)c1 |
| InChI | InChI=1S/C21H19F3O/c1-16-6-5-7-17(14-16)10-11-18(15-21(22,23)24)12-13-20(25)19-8-3-2-4-9-19/h2-9,14,18H,12-13,15H2,1H3 |
| InChIKey | KACYFNWYTNJLSR-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|