C26H22ClN3O5S — CID 171061276
3-[3-[(8-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]propoxy]-7-methoxy-2-(4-methoxyphenyl)chromen-4-one (PubChem CID 171061276) has the molecular formula C26H22ClN3O5S and a molecular weight of 524.00 g/mol. Its IUPAC name is 3-[3-[(8-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]propoxy]-7-methoxy-2-(4-methoxyphenyl)chromen-4-one.
| Compound Name | 3-[3-[(8-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]propoxy]-7-methoxy-2-(4-methoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 171061276 |
| Molecular Formula | C26H22ClN3O5S |
| Molecular Weight | 524.00 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | 3-[3-[(8-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]propoxy]-7-methoxy-2-(4-methoxyphenyl)chromen-4-one |
| SMILES | COc1ccc(-c2oc3cc(OC)ccc3c(=O)c2OCCCSc2nnc3c(Cl)cccn23)cc1 |
| InChI | InChI=1S/C26H22ClN3O5S/c1-32-17-8-6-16(7-9-17)23-24(22(31)19-11-10-18(33-2)15-21(19)35-23)34-13-4-14-36-26-29-28-25-20(27)5-3-12-30(25)26/h3,5-12,15H,4,13-14H2,1-2H3 |
| InChIKey | BGHUFDIZGVAFBC-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 88.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.00 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|