C15H17Br2FO — CID 171078952
1-bromo-3-[1-bromo-3-(2,2-dimethylbut-3-ynoxy)propyl]-2-fluorobenzene (PubChem CID 171078952) has the molecular formula C15H17Br2FO and a molecular weight of 392.11 g/mol. Its IUPAC name is 1-bromo-3-[1-bromo-3-(2,2-dimethylbut-3-ynoxy)propyl]-2-fluorobenzene.
| Compound Name | 1-bromo-3-[1-bromo-3-(2,2-dimethylbut-3-ynoxy)propyl]-2-fluorobenzene |
|---|---|
| PubChem CID | 171078952 |
| Molecular Formula | C15H17Br2FO |
| Molecular Weight | 392.11 g/mol |
| Exact Mass | 389.96 |
| IUPAC Name | 1-bromo-3-[1-bromo-3-(2,2-dimethylbut-3-ynoxy)propyl]-2-fluorobenzene |
| SMILES | C#CC(C)(C)COCCC(Br)c1cccc(Br)c1F |
| InChI | InChI=1S/C15H17Br2FO/c1-4-15(2,3)10-19-9-8-12(16)11-6-5-7-13(17)14(11)18/h1,5-7,12H,8-10H2,2-3H3 |
| InChIKey | SVCDWKIQFJDXHA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.11 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|