C24H27FN4O5S — CID 171085827
tert-butyl 3-[7-fluoro-6-(4-methylphenyl)sulfonyloxypyrido[2,3-b]pyrazin-3-yl]piperidine-1-carboxylate (PubChem CID 171085827) has the molecular formula C24H27FN4O5S and a molecular weight of 502.57 g/mol. Its IUPAC name is tert-butyl 3-[7-fluoro-6-(4-methylphenyl)sulfonyloxypyrido[2,3-b]pyrazin-3-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[7-fluoro-6-(4-methylphenyl)sulfonyloxypyrido[2,3-b]pyrazin-3-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 171085827 |
| Molecular Formula | C24H27FN4O5S |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | tert-butyl 3-[7-fluoro-6-(4-methylphenyl)sulfonyloxypyrido[2,3-b]pyrazin-3-yl]piperidine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2nc3nc(C4CCCN(C(=O)OC(C)(C)C)C4)cnc3cc2F)cc1 |
| InChI | InChI=1S/C24H27FN4O5S/c1-15-7-9-17(10-8-15)35(31,32)34-22-18(25)12-19-21(28-22)27-20(13-26-19)16-6-5-11-29(14-16)23(30)33-24(2,3)4/h7-10,12-13,16H,5-6,11,14H2,1-4H3 |
| InChIKey | XNCMKTQBXLOVEX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 111.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|