2,2-dimethyl-6-methylidenepiperazine;molecular hydrogen

C7H18N2 — CID 171086633

IUPAC2,2-dimethyl-6-methylidenepiperazine;molecular hydrogen
SMILESC=C1CNCC(C)(C)N1.[H][H].[H][H]
InChIInChI=1S/C7H14N2.2H2/c1-6-4-8-5-7(2,3)9-6;;/h8-9H,1,4-5H2,2-3H3;2*1H
InChIKeyLXMHVHSJPRVCBF-UHFFFAOYSA-N
MW130.24 g/mol
LogP0.96
Rot. Bonds

About 2,2-dimethyl-6-methylidenepiperazine;molecular hydrogen

2,2-dimethyl-6-methylidenepiperazine;molecular hydrogen (PubChem CID 171086633) has the molecular formula C7H18N2 and a molecular weight of 130.24 g/mol. Its IUPAC name is 2,2-dimethyl-6-methylidenepiperazine;molecular hydrogen.

Molecular Properties

Compound Name2,2-dimethyl-6-methylidenepiperazine;molecular hydrogen
PubChem CID171086633
Molecular FormulaC7H18N2
Molecular Weight130.24 g/mol
Exact Mass130.15
IUPAC Name2,2-dimethyl-6-methylidenepiperazine;molecular hydrogen
SMILESC=C1CNCC(C)(C)N1.[H][H].[H][H]
InChIInChI=1S/C7H14N2.2H2/c1-6-4-8-5-7(2,3)9-6;;/h8-9H,1,4-5H2,2-3H3;2*1H
InChIKeyLXMHVHSJPRVCBF-UHFFFAOYSA-N
XLogP0.96
TPSA24.06 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500130.24
LogP ≤ 50.96
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2,2-dimethyl-6-methylidenepiperazine;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-dimethyl-6-methylidenepiperazine;molecular hydrogen?
The IUPAC name of 2,2-dimethyl-6-methylidenepiperazine;molecular hydrogen (CID 171086633) is 2,2-dimethyl-6-methylidenepiperazine;molecular hydrogen.
What is the SMILES notation for 2,2-dimethyl-6-methylidenepiperazine;molecular hydrogen?
The canonical SMILES for 2,2-dimethyl-6-methylidenepiperazine;molecular hydrogen is C=C1CNCC(C)(C)N1.[H][H].[H][H].
What is the InChIKey of 2,2-dimethyl-6-methylidenepiperazine;molecular hydrogen?
The InChIKey is LXMHVHSJPRVCBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2.2H2/c1-6-4-8-5-7(2,3)9-6;;/h8-9H,1,4-5H2,2-3H3;2*1H.
What are the key properties of 2,2-dimethyl-6-methylidenepiperazine;molecular hydrogen?
2,2-dimethyl-6-methylidenepiperazine;molecular hydrogen has a molecular weight of 130.24 g/mol, XLogP of 0.96, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-6-methylidenepiperazine;molecular hydrogen is sourced from PubChem (CID 171086633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).