About ethane;2-methylidene-1,8-diazaspiro[4.5]decane
ethane;2-methylidene-1,8-diazaspiro[4.5]decane (PubChem CID 155714977) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is ethane;2-methylidene-1,8-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | ethane;2-methylidene-1,8-diazaspiro[4.5]decane |
| PubChem CID | 155714977 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | ethane;2-methylidene-1,8-diazaspiro[4.5]decane |
| SMILES | C=C1CCC2(CCNCC2)N1.CC |
| InChI | InChI=1S/C9H16N2.C2H6/c1-8-2-3-9(11-8)4-6-10-7-5-9;1-2/h10-11H,1-7H2;1-2H3 |
| InChIKey | LHTSOWOPWFBENN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-methylidene-1,8-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylidene-1,8-diazaspiro[4.5]decane?
The IUPAC name of ethane;2-methylidene-1,8-diazaspiro[4.5]decane (CID 155714977) is ethane;2-methylidene-1,8-diazaspiro[4.5]decane.
What is the SMILES notation for ethane;2-methylidene-1,8-diazaspiro[4.5]decane?
The canonical SMILES for ethane;2-methylidene-1,8-diazaspiro[4.5]decane is C=C1CCC2(CCNCC2)N1.CC.
What is the InChIKey of ethane;2-methylidene-1,8-diazaspiro[4.5]decane?
The InChIKey is LHTSOWOPWFBENN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2.C2H6/c1-8-2-3-9(11-8)4-6-10-7-5-9;1-2/h10-11H,1-7H2;1-2H3.
What are the key properties of ethane;2-methylidene-1,8-diazaspiro[4.5]decane?
ethane;2-methylidene-1,8-diazaspiro[4.5]decane has a molecular weight of 182.31 g/mol, XLogP of 2.03, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylidene-1,8-diazaspiro[4.5]decane is sourced from PubChem (CID 155714977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).