C8H16Cl2N2 — CID 139741164
9-methylidene-1,7-diazaspiro[4.4]nonane;dihydrochloride (PubChem CID 139741164) has the molecular formula C8H16Cl2N2 and a molecular weight of 211.14 g/mol. Its IUPAC name is 9-methylidene-1,7-diazaspiro[4.4]nonane;dihydrochloride.
| Compound Name | 9-methylidene-1,7-diazaspiro[4.4]nonane;dihydrochloride |
|---|---|
| PubChem CID | 139741164 |
| Molecular Formula | C8H16Cl2N2 |
| Molecular Weight | 211.14 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 9-methylidene-1,7-diazaspiro[4.4]nonane;dihydrochloride |
| SMILES | C=C1CNCC12CCCN2.Cl.Cl |
| InChI | InChI=1S/C8H14N2.2ClH/c1-7-5-9-6-8(7)3-2-4-10-8;;/h9-10H,1-6H2;2*1H |
| InChIKey | XMGKNQQWNMXYEO-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.14 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|