C7H15Cl2N3O — CID 162422730
2,5,9-triazaspiro[3.6]decan-10-one;dihydrochloride (PubChem CID 162422730) has the molecular formula C7H15Cl2N3O and a molecular weight of 228.12 g/mol. Its IUPAC name is 2,5,9-triazaspiro[3.6]decan-10-one;dihydrochloride.
| Compound Name | 2,5,9-triazaspiro[3.6]decan-10-one;dihydrochloride |
|---|---|
| PubChem CID | 162422730 |
| Molecular Formula | C7H15Cl2N3O |
| Molecular Weight | 228.12 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 2,5,9-triazaspiro[3.6]decan-10-one;dihydrochloride |
| SMILES | Cl.Cl.O=C1NCCCNC12CNC2 |
| InChI | InChI=1S/C7H13N3O.2ClH/c11-6-7(4-8-5-7)10-3-1-2-9-6;;/h8,10H,1-5H2,(H,9,11);2*1H |
| InChIKey | JWDODIVQICCJIP-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.12 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |