C14H25N3O5S — CID 171086966
2-[4-(carboxymethyl)-7-[2-[methyl(methylidene)-λ4-sulfanyl]-2-oxoethyl]-1,4,7-triazonan-1-yl]acetic acid (PubChem CID 171086966) has the molecular formula C14H25N3O5S and a molecular weight of 347.44 g/mol. Its IUPAC name is 2-[4-(carboxymethyl)-7-[2-[methyl(methylidene)-λ4-sulfanyl]-2-oxoethyl]-1,4,7-triazonan-1-yl]acetic acid.
| Compound Name | 2-[4-(carboxymethyl)-7-[2-[methyl(methylidene)-λ4-sulfanyl]-2-oxoethyl]-1,4,7-triazonan-1-yl]acetic acid |
|---|---|
| PubChem CID | 171086966 |
| Molecular Formula | C14H25N3O5S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 2-[4-(carboxymethyl)-7-[2-[methyl(methylidene)-λ4-sulfanyl]-2-oxoethyl]-1,4,7-triazonan-1-yl]acetic acid |
| SMILES | C=[S@](C)C(=O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C14H25N3O5S/c1-23(2)14(22)11-17-7-5-15(9-12(18)19)3-4-16(6-8-17)10-13(20)21/h1,3-11H2,2H3,(H,18,19)(H,20,21)/t23-/m1/s1 |
| InChIKey | JQWRQQKTRKCCOC-HSZRJFAPSA-N |
| XLogP | -1.07 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|