C25H23ClN2O3S2 — CID 17109024
1-chloro-N-[4-(cyclohexylsulfamoyl)phenyl]benzo[e][1]benzothiole-2-carboxamide (PubChem CID 17109024) has the molecular formula C25H23ClN2O3S2 and a molecular weight of 499.06 g/mol. Its IUPAC name is 1-chloro-N-[4-(cyclohexylsulfamoyl)phenyl]benzo[e][1]benzothiole-2-carboxamide.
| Compound Name | 1-chloro-N-[4-(cyclohexylsulfamoyl)phenyl]benzo[e][1]benzothiole-2-carboxamide |
|---|---|
| PubChem CID | 17109024 |
| Molecular Formula | C25H23ClN2O3S2 |
| Molecular Weight | 499.06 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | 1-chloro-N-[4-(cyclohexylsulfamoyl)phenyl]benzo[e][1]benzothiole-2-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)NC2CCCCC2)cc1)c1sc2ccc3ccccc3c2c1Cl |
| InChI | InChI=1S/C25H23ClN2O3S2/c26-23-22-20-9-5-4-6-16(20)10-15-21(22)32-24(23)25(29)27-17-11-13-19(14-12-17)33(30,31)28-18-7-2-1-3-8-18/h4-6,9-15,18,28H,1-3,7-8H2,(H,27,29) |
| InChIKey | PUBUJWKAPLVSJE-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.06 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |