C19H13ClN2O3S2 — CID 19164356
1-chloro-N-(4-sulfamoylphenyl)benzo[e][1]benzothiole-2-carboxamide (PubChem CID 19164356) has the molecular formula C19H13ClN2O3S2 and a molecular weight of 416.91 g/mol. Its IUPAC name is 1-chloro-N-(4-sulfamoylphenyl)benzo[e][1]benzothiole-2-carboxamide.
| Compound Name | 1-chloro-N-(4-sulfamoylphenyl)benzo[e][1]benzothiole-2-carboxamide |
|---|---|
| PubChem CID | 19164356 |
| Molecular Formula | C19H13ClN2O3S2 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.01 |
| IUPAC Name | 1-chloro-N-(4-sulfamoylphenyl)benzo[e][1]benzothiole-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)c2sc3ccc4ccccc4c3c2Cl)cc1 |
| InChI | InChI=1S/C19H13ClN2O3S2/c20-17-16-14-4-2-1-3-11(14)5-10-15(16)26-18(17)19(23)22-12-6-8-13(9-7-12)27(21,24)25/h1-10H,(H,22,23)(H2,21,24,25) |
| InChIKey | GPAFHAWORBKESJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |