C20H10Cl2F3NOS — CID 19164339
1-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]benzo[e][1]benzothiole-2-carboxamide (PubChem CID 19164339) has the molecular formula C20H10Cl2F3NOS and a molecular weight of 440.27 g/mol. Its IUPAC name is 1-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]benzo[e][1]benzothiole-2-carboxamide.
| Compound Name | 1-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]benzo[e][1]benzothiole-2-carboxamide |
|---|---|
| PubChem CID | 19164339 |
| Molecular Formula | C20H10Cl2F3NOS |
| Molecular Weight | 440.27 g/mol |
| Exact Mass | 438.98 |
| IUPAC Name | 1-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]benzo[e][1]benzothiole-2-carboxamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1Cl)c1sc2ccc3ccccc3c2c1Cl |
| InChI | InChI=1S/C20H10Cl2F3NOS/c21-13-7-6-11(20(23,24)25)9-14(13)26-19(27)18-17(22)16-12-4-2-1-3-10(12)5-8-15(16)28-18/h1-9H,(H,26,27) |
| InChIKey | XEDJKBQTOVMSCE-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.27 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |