C24H20ClNO3S — CID 19164365
butyl 4-[(1-chlorobenzo[e][1]benzothiole-2-carbonyl)amino]benzoate (PubChem CID 19164365) has the molecular formula C24H20ClNO3S and a molecular weight of 437.95 g/mol. Its IUPAC name is butyl 4-[(1-chlorobenzo[e][1]benzothiole-2-carbonyl)amino]benzoate.
| Compound Name | butyl 4-[(1-chlorobenzo[e][1]benzothiole-2-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 19164365 |
| Molecular Formula | C24H20ClNO3S |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | butyl 4-[(1-chlorobenzo[e][1]benzothiole-2-carbonyl)amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)c2sc3ccc4ccccc4c3c2Cl)cc1 |
| InChI | InChI=1S/C24H20ClNO3S/c1-2-3-14-29-24(28)16-8-11-17(12-9-16)26-23(27)22-21(25)20-18-7-5-4-6-15(18)10-13-19(20)30-22/h4-13H,2-3,14H2,1H3,(H,26,27) |
| InChIKey | ZDRRZCWDZDWCFA-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|