C21H18F9IN4O2 — CID 171100288
4-[2,2,2-trifluoro-1-(4-iodobutoxy)ethyl]-2,5-bis[5-(trifluoromethyl)-3-pyridinyl]-3,4-dihydropyrazol-3-ol (PubChem CID 171100288) has the molecular formula C21H18F9IN4O2 and a molecular weight of 656.29 g/mol. Its IUPAC name is 4-[2,2,2-trifluoro-1-(4-iodobutoxy)ethyl]-2,5-bis[5-(trifluoromethyl)-3-pyridinyl]-3,4-dihydropyrazol-3-ol.
| Compound Name | 4-[2,2,2-trifluoro-1-(4-iodobutoxy)ethyl]-2,5-bis[5-(trifluoromethyl)-3-pyridinyl]-3,4-dihydropyrazol-3-ol |
|---|---|
| PubChem CID | 171100288 |
| Molecular Formula | C21H18F9IN4O2 |
| Molecular Weight | 656.29 g/mol |
| Exact Mass | 656.03 |
| IUPAC Name | 4-[2,2,2-trifluoro-1-(4-iodobutoxy)ethyl]-2,5-bis[5-(trifluoromethyl)-3-pyridinyl]-3,4-dihydropyrazol-3-ol |
| SMILES | OC1C(C(OCCCCI)C(F)(F)F)C(c2cncc(C(F)(F)F)c2)=NN1c1cncc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H18F9IN4O2/c22-19(23,24)12-5-11(7-32-8-12)16-15(17(21(28,29)30)37-4-2-1-3-31)18(36)35(34-16)14-6-13(9-33-10-14)20(25,26)27/h5-10,15,17-18,36H,1-4H2 |
| InChIKey | FXZHCRNZHPWLJW-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.29 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|