C24H15F15I2N2O2 — CID 174317360
2,5-bis[3,5-bis(trifluoromethyl)phenyl]-4-(1,3-diiodopropan-2-yl)-4-(2,2,2-trifluoro-1-hydroxyethyl)-3H-pyrazol-3-ol (PubChem CID 174317360) has the molecular formula C24H15F15I2N2O2 and a molecular weight of 902.17 g/mol. Its IUPAC name is 2,5-bis[3,5-bis(trifluoromethyl)phenyl]-4-(1,3-diiodopropan-2-yl)-4-(2,2,2-trifluoro-1-hydroxyethyl)-3H-pyrazol-3-ol.
| Compound Name | 2,5-bis[3,5-bis(trifluoromethyl)phenyl]-4-(1,3-diiodopropan-2-yl)-4-(2,2,2-trifluoro-1-hydroxyethyl)-3H-pyrazol-3-ol |
|---|---|
| PubChem CID | 174317360 |
| Molecular Formula | C24H15F15I2N2O2 |
| Molecular Weight | 902.17 g/mol |
| Exact Mass | 901.90 |
| IUPAC Name | 2,5-bis[3,5-bis(trifluoromethyl)phenyl]-4-(1,3-diiodopropan-2-yl)-4-(2,2,2-trifluoro-1-hydroxyethyl)-3H-pyrazol-3-ol |
| SMILES | OC1N(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)N=C(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1(C(CI)CI)C(O)C(F)(F)F |
| InChI | InChI=1S/C24H15F15I2N2O2/c25-20(26,27)10-1-9(2-11(3-10)21(28,29)30)16-19(14(7-40)8-41,17(44)24(37,38)39)18(45)43(42-16)15-5-12(22(31,32)33)4-13(6-15)23(34,35)36/h1-6,14,17-18,44-45H,7-8H2 |
| InChIKey | INPZFAAGJDWXPI-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 56.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 902.17 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|