C19H15F5N6O3 — CID 171104223
3-(difluoromethyl)-N-methyl-N-[1-(4-nitro-1-pyrimidin-2-ylpyrazol-5-yl)ethyl]-5-(trifluoromethyl)benzamide (PubChem CID 171104223) has the molecular formula C19H15F5N6O3 and a molecular weight of 470.36 g/mol. Its IUPAC name is 3-(difluoromethyl)-N-methyl-N-[1-(4-nitro-1-pyrimidin-2-ylpyrazol-5-yl)ethyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 3-(difluoromethyl)-N-methyl-N-[1-(4-nitro-1-pyrimidin-2-ylpyrazol-5-yl)ethyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 171104223 |
| Molecular Formula | C19H15F5N6O3 |
| Molecular Weight | 470.36 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | 3-(difluoromethyl)-N-methyl-N-[1-(4-nitro-1-pyrimidin-2-ylpyrazol-5-yl)ethyl]-5-(trifluoromethyl)benzamide |
| SMILES | CC(c1c([N+](=O)[O-])cnn1-c1ncccn1)N(C)C(=O)c1cc(C(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H15F5N6O3/c1-10(15-14(30(32)33)9-27-29(15)18-25-4-3-5-26-18)28(2)17(31)12-6-11(16(20)21)7-13(8-12)19(22,23)24/h3-10,16H,1-2H3 |
| InChIKey | WHOFJLQQEHZSNH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.36 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|