C13H17FN2O2 — CID 171106825
ethane;(4-fluoro-5-prop-2-enoxy-1H-indazol-7-yl)methanol (PubChem CID 171106825) has the molecular formula C13H17FN2O2 and a molecular weight of 252.29 g/mol. Its IUPAC name is ethane;(4-fluoro-5-prop-2-enoxy-1H-indazol-7-yl)methanol.
| Compound Name | ethane;(4-fluoro-5-prop-2-enoxy-1H-indazol-7-yl)methanol |
|---|---|
| PubChem CID | 171106825 |
| Molecular Formula | C13H17FN2O2 |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | ethane;(4-fluoro-5-prop-2-enoxy-1H-indazol-7-yl)methanol |
| SMILES | C=CCOc1cc(CO)c2[nH]ncc2c1F.CC |
| InChI | InChI=1S/C11H11FN2O2.C2H6/c1-2-3-16-9-4-7(6-15)11-8(10(9)12)5-13-14-11;1-2/h2,4-5,15H,1,3,6H2,(H,13,14);1-2H3 |
| InChIKey | QTXCDGLLMVEQRO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|