C14H15Cl2N7 — CID 171107318
5,7-dichloro-6-methyl-3-[3-(2-methyltetrazol-5-yl)cyclopentyl]imidazo[4,5-b]pyridine (PubChem CID 171107318) has the molecular formula C14H15Cl2N7 and a molecular weight of 352.23 g/mol. Its IUPAC name is 5,7-dichloro-6-methyl-3-[3-(2-methyltetrazol-5-yl)cyclopentyl]imidazo[4,5-b]pyridine.
| Compound Name | 5,7-dichloro-6-methyl-3-[3-(2-methyltetrazol-5-yl)cyclopentyl]imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 171107318 |
| Molecular Formula | C14H15Cl2N7 |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 5,7-dichloro-6-methyl-3-[3-(2-methyltetrazol-5-yl)cyclopentyl]imidazo[4,5-b]pyridine |
| SMILES | Cc1c(Cl)nc2c(ncn2C2CCC(c3nnn(C)n3)C2)c1Cl |
| InChI | InChI=1S/C14H15Cl2N7/c1-7-10(15)11-14(18-12(7)16)23(6-17-11)9-4-3-8(5-9)13-19-21-22(2)20-13/h6,8-9H,3-5H2,1-2H3 |
| InChIKey | PWAHQGCGZDDYSE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|