C18H26Cl2N4O2 — CID 171107204
(3S)-3-(5,7-dichloro-6-methylimidazo[4,5-b]pyridin-3-yl)cyclopentane-1-carbonitrile;ethane;propane-2,2-diol (PubChem CID 171107204) has the molecular formula C18H26Cl2N4O2 and a molecular weight of 401.34 g/mol. Its IUPAC name is (3S)-3-(5,7-dichloro-6-methylimidazo[4,5-b]pyridin-3-yl)cyclopentane-1-carbonitrile;ethane;propane-2,2-diol.
| Compound Name | (3S)-3-(5,7-dichloro-6-methylimidazo[4,5-b]pyridin-3-yl)cyclopentane-1-carbonitrile;ethane;propane-2,2-diol |
|---|---|
| PubChem CID | 171107204 |
| Molecular Formula | C18H26Cl2N4O2 |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | (3S)-3-(5,7-dichloro-6-methylimidazo[4,5-b]pyridin-3-yl)cyclopentane-1-carbonitrile;ethane;propane-2,2-diol |
| SMILES | CC.CC(C)(O)O.Cc1c(Cl)nc2c(ncn2[C@H]2CCC(C#N)C2)c1Cl |
| InChI | InChI=1S/C13H12Cl2N4.C3H8O2.C2H6/c1-7-10(14)11-13(18-12(7)15)19(6-17-11)9-3-2-8(4-9)5-16;1-3(2,4)5;1-2/h6,8-9H,2-4H2,1H3;4-5H,1-2H3;1-2H3/t8?,9-;;/m0../s1 |
| InChIKey | RVZJTLMCGIOIHA-AHBBCRTASA-N |
| XLogP | 4.64 |
| TPSA | 94.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|