C18H21ClF2N8 — CID 171107099
8-chloro-11-(difluoromethyl)-5-[(1S,3R)-3-(2-methyltetrazol-5-yl)cyclopentyl]-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaene;ethane (PubChem CID 171107099) has the molecular formula C18H21ClF2N8 and a molecular weight of 422.87 g/mol. Its IUPAC name is 8-chloro-11-(difluoromethyl)-5-[(1S,3R)-3-(2-methyltetrazol-5-yl)cyclopentyl]-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaene;ethane.
| Compound Name | 8-chloro-11-(difluoromethyl)-5-[(1S,3R)-3-(2-methyltetrazol-5-yl)cyclopentyl]-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaene;ethane |
|---|---|
| PubChem CID | 171107099 |
| Molecular Formula | C18H21ClF2N8 |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 8-chloro-11-(difluoromethyl)-5-[(1S,3R)-3-(2-methyltetrazol-5-yl)cyclopentyl]-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaene;ethane |
| SMILES | CC.Cn1nnc([C@@H]2CC[C@H](n3cnc4c5[nH]c(C(F)F)cc5c(Cl)nc43)C2)n1 |
| InChI | InChI=1S/C16H15ClF2N8.C2H6/c1-26-24-15(23-25-26)7-2-3-8(4-7)27-6-20-12-11-9(13(17)22-16(12)27)5-10(21-11)14(18)19;1-2/h5-8,14,21H,2-4H2,1H3;1-2H3/t7-,8+;/m1./s1 |
| InChIKey | KHOJAXQMCCSAKJ-WLYNEOFISA-N |
| XLogP | 4.56 |
| TPSA | 90.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|