C18H24ClN5O4 — CID 171107342
5-(8-chloro-11-methyl-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-5-yl)-N-methyloxolane-2-carboxamide;propane-2,2-diol (PubChem CID 171107342) has the molecular formula C18H24ClN5O4 and a molecular weight of 409.87 g/mol. Its IUPAC name is 5-(8-chloro-11-methyl-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-5-yl)-N-methyloxolane-2-carboxamide;propane-2,2-diol.
| Compound Name | 5-(8-chloro-11-methyl-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-5-yl)-N-methyloxolane-2-carboxamide;propane-2,2-diol |
|---|---|
| PubChem CID | 171107342 |
| Molecular Formula | C18H24ClN5O4 |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 5-(8-chloro-11-methyl-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-5-yl)-N-methyloxolane-2-carboxamide;propane-2,2-diol |
| SMILES | CC(C)(O)O.CNC(=O)C1CCC(n2cnc3c4[nH]c(C)cc4c(Cl)nc32)O1 |
| InChI | InChI=1S/C15H16ClN5O2.C3H8O2/c1-7-5-8-11(19-7)12-14(20-13(8)16)21(6-18-12)10-4-3-9(23-10)15(22)17-2;1-3(2,4)5/h5-6,9-10,19H,3-4H2,1-2H3,(H,17,22);4-5H,1-2H3 |
| InChIKey | VTSCASKLDXNGIG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 125.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|