C16H21ClN4O — CID 171107361
[3-(8-chloro-11-methyl-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7-tetraen-5-yl)-2-methylcyclopentyl]methanol (PubChem CID 171107361) has the molecular formula C16H21ClN4O and a molecular weight of 320.82 g/mol. Its IUPAC name is [3-(8-chloro-11-methyl-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7-tetraen-5-yl)-2-methylcyclopentyl]methanol.
| Compound Name | [3-(8-chloro-11-methyl-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7-tetraen-5-yl)-2-methylcyclopentyl]methanol |
|---|---|
| PubChem CID | 171107361 |
| Molecular Formula | C16H21ClN4O |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | [3-(8-chloro-11-methyl-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7-tetraen-5-yl)-2-methylcyclopentyl]methanol |
| SMILES | CC1Cc2c(Cl)nc3c(ncn3C3CCC(CO)C3C)c2N1 |
| InChI | InChI=1S/C16H21ClN4O/c1-8-5-11-13(19-8)14-16(20-15(11)17)21(7-18-14)12-4-3-10(6-22)9(12)2/h7-10,12,19,22H,3-6H2,1-2H3 |
| InChIKey | VESDWUQXFSIPOH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|