C11H18N2O3 — CID 171107387
tert-butyl N-(3-oxo-2-azabicyclo[2.2.1]heptan-4-yl)carbamate (PubChem CID 171107387) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is tert-butyl N-(3-oxo-2-azabicyclo[2.2.1]heptan-4-yl)carbamate.
| Compound Name | tert-butyl N-(3-oxo-2-azabicyclo[2.2.1]heptan-4-yl)carbamate |
|---|---|
| PubChem CID | 171107387 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | tert-butyl N-(3-oxo-2-azabicyclo[2.2.1]heptan-4-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC12CCC(C1)NC2=O |
| InChI | InChI=1S/C11H18N2O3/c1-10(2,3)16-9(15)13-11-5-4-7(6-11)12-8(11)14/h7H,4-6H2,1-3H3,(H,12,14)(H,13,15) |
| InChIKey | NLAUWGZLGYUAIE-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |