C21H26FNO8 — CID 171107648
tert-butyl N-[3-[[2-fluoro-3-formyl-4-(trihydroxymethoxy)phenoxy]methyl]phenyl]carbamate;methane (PubChem CID 171107648) has the molecular formula C21H26FNO8 and a molecular weight of 439.44 g/mol. Its IUPAC name is tert-butyl N-[3-[[2-fluoro-3-formyl-4-(trihydroxymethoxy)phenoxy]methyl]phenyl]carbamate;methane.
| Compound Name | tert-butyl N-[3-[[2-fluoro-3-formyl-4-(trihydroxymethoxy)phenoxy]methyl]phenyl]carbamate;methane |
|---|---|
| PubChem CID | 171107648 |
| Molecular Formula | C21H26FNO8 |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | tert-butyl N-[3-[[2-fluoro-3-formyl-4-(trihydroxymethoxy)phenoxy]methyl]phenyl]carbamate;methane |
| SMILES | C.CC(C)(C)OC(=O)Nc1cccc(COc2ccc(OC(O)(O)O)c(C=O)c2F)c1 |
| InChI | InChI=1S/C20H22FNO8.CH4/c1-19(2,3)30-18(24)22-13-6-4-5-12(9-13)11-28-16-8-7-15(29-20(25,26)27)14(10-23)17(16)21;/h4-10,25-27H,11H2,1-3H3,(H,22,24);1H4 |
| InChIKey | WKULPPUKXVQRGO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|