C14H26BFO2 — CID 171110175
2-(1-fluoro-4,4-dimethylhex-1-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171110175) has the molecular formula C14H26BFO2 and a molecular weight of 256.17 g/mol. Its IUPAC name is 2-(1-fluoro-4,4-dimethylhex-1-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(1-fluoro-4,4-dimethylhex-1-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171110175 |
| Molecular Formula | C14H26BFO2 |
| Molecular Weight | 256.17 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 2-(1-fluoro-4,4-dimethylhex-1-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCC(C)(C)CC=C(F)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H26BFO2/c1-8-12(2,3)10-9-11(16)15-17-13(4,5)14(6,7)18-15/h9H,8,10H2,1-7H3 |
| InChIKey | UJEYMYXMGBRETK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.17 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|