About (6E,8E)-5-oxotetradeca-6,8-dienoic acid
(6E,8E)-5-oxotetradeca-6,8-dienoic acid (PubChem CID 171119092) has the molecular formula C14H22O3
and a molecular weight of 238.33 g/mol. Its IUPAC name is (6E,8E)-5-oxotetradeca-6,8-dienoic acid.
Molecular Properties
| Compound Name | (6E,8E)-5-oxotetradeca-6,8-dienoic acid |
| PubChem CID | 171119092 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | (6E,8E)-5-oxotetradeca-6,8-dienoic acid |
| SMILES | CCCCC/C=C/C=C/C(=O)CCCC(=O)O |
| InChI | InChI=1S/C14H22O3/c1-2-3-4-5-6-7-8-10-13(15)11-9-12-14(16)17/h6-8,10H,2-5,9,11-12H2,1H3,(H,16,17)/b7-6+,10-8+ |
| InChIKey | CUBKHJDNGLGYAG-LQPGMRSMSA-N |
| XLogP | 3.50 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (6E,8E)-5-oxotetradeca-6,8-dienoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E,8E)-5-oxotetradeca-6,8-dienoic acid?
The IUPAC name of (6E,8E)-5-oxotetradeca-6,8-dienoic acid (CID 171119092) is (6E,8E)-5-oxotetradeca-6,8-dienoic acid.
What is the SMILES notation for (6E,8E)-5-oxotetradeca-6,8-dienoic acid?
The canonical SMILES for (6E,8E)-5-oxotetradeca-6,8-dienoic acid is CCCCC/C=C/C=C/C(=O)CCCC(=O)O.
What is the InChIKey of (6E,8E)-5-oxotetradeca-6,8-dienoic acid?
The InChIKey is CUBKHJDNGLGYAG-LQPGMRSMSA-N. The full InChI is InChI=1S/C14H22O3/c1-2-3-4-5-6-7-8-10-13(15)11-9-12-14(16)17/h6-8,10H,2-5,9,11-12H2,1H3,(H,16,17)/b7-6+,10-8+.
What are the key properties of (6E,8E)-5-oxotetradeca-6,8-dienoic acid?
(6E,8E)-5-oxotetradeca-6,8-dienoic acid has a molecular weight of 238.33 g/mol, XLogP of 3.50, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6E,8E)-5-oxotetradeca-6,8-dienoic acid is sourced from PubChem (CID 171119092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).