C36H45N5O3 — CID 171119732
3-[(18R)-18-[(4S)-4-amino-6-methyl-3-oxoheptyl]-3,8,13,17,17-pentamethyl-21,23-dihydro-18H-porphyrin-2-yl]propanoic acid (PubChem CID 171119732) has the molecular formula C36H45N5O3 and a molecular weight of 595.79 g/mol. Its IUPAC name is 3-[(18R)-18-[(4S)-4-amino-6-methyl-3-oxoheptyl]-3,8,13,17,17-pentamethyl-21,23-dihydro-18H-porphyrin-2-yl]propanoic acid.
| Compound Name | 3-[(18R)-18-[(4S)-4-amino-6-methyl-3-oxoheptyl]-3,8,13,17,17-pentamethyl-21,23-dihydro-18H-porphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 171119732 |
| Molecular Formula | C36H45N5O3 |
| Molecular Weight | 595.79 g/mol |
| Exact Mass | 595.35 |
| IUPAC Name | 3-[(18R)-18-[(4S)-4-amino-6-methyl-3-oxoheptyl]-3,8,13,17,17-pentamethyl-21,23-dihydro-18H-porphyrin-2-yl]propanoic acid |
| SMILES | CC1=Cc2cc3[nH]c(cc4nc(cc5[nH]c(cc1n2)cc5C)C(C)(C)[C@H]4CCC(=O)[C@@H](N)CC(C)C)c(CCC(=O)O)c3C |
| InChI | InChI=1S/C36H45N5O3/c1-19(2)12-27(37)33(42)10-9-26-32-17-31-25(8-11-35(43)44)22(5)30(40-31)16-24-13-20(3)28(38-24)15-23-14-21(4)29(39-23)18-34(41-32)36(26,6)7/h13-19,26-27,39-40H,8-12,37H2,1-7H3,(H,43,44)/b23-15-,24-16-,28-15-,29-18-,30-16-,31-17-,32-17-,34-18-/t26-,27-/m0/s1 |
| InChIKey | KIVQKSRXCQACMO-FMDSIIPBSA-N |
| XLogP | 7.29 |
| TPSA | 137.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.79 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |