C25H33ClO9 — CID 171119861
[(1R,2R,3S,7S,8R,9S,13S,14R,17S)-7-acetyloxy-13-chloro-2,17-dihydroxy-4,8,17-trimethyl-12-methylidene-16-oxo-15,18-dioxatetracyclo[9.6.1.01,14.03,8]octadec-4-en-9-yl] propanoate (PubChem CID 171119861) has the molecular formula C25H33ClO9 and a molecular weight of 512.98 g/mol. Its IUPAC name is [(1R,2R,3S,7S,8R,9S,13S,14R,17S)-7-acetyloxy-13-chloro-2,17-dihydroxy-4,8,17-trimethyl-12-methylidene-16-oxo-15,18-dioxatetracyclo[9.6.1.01,14.03,8]octadec-4-en-9-yl] propanoate.
| Compound Name | [(1R,2R,3S,7S,8R,9S,13S,14R,17S)-7-acetyloxy-13-chloro-2,17-dihydroxy-4,8,17-trimethyl-12-methylidene-16-oxo-15,18-dioxatetracyclo[9.6.1.01,14.03,8]octadec-4-en-9-yl] propanoate |
|---|---|
| PubChem CID | 171119861 |
| Molecular Formula | C25H33ClO9 |
| Molecular Weight | 512.98 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | [(1R,2R,3S,7S,8R,9S,13S,14R,17S)-7-acetyloxy-13-chloro-2,17-dihydroxy-4,8,17-trimethyl-12-methylidene-16-oxo-15,18-dioxatetracyclo[9.6.1.01,14.03,8]octadec-4-en-9-yl] propanoate |
| SMILES | C=C1C2C[C@H](OC(=O)CC)[C@@]3(C)[C@@H](OC(C)=O)CC=C(C)[C@@H]3[C@@H](O)[C@@]3(O2)[C@@H](OC(=O)[C@@]3(C)O)[C@H]1Cl |
| InChI | InChI=1S/C25H33ClO9/c1-7-17(28)33-16-10-14-12(3)19(26)21-25(35-14,24(6,31)22(30)34-21)20(29)18-11(2)8-9-15(23(16,18)5)32-13(4)27/h8,14-16,18-21,29,31H,3,7,9-10H2,1-2,4-6H3/t14?,15-,16-,18+,19-,20+,21-,23+,24+,25+/m0/s1 |
| InChIKey | DSAOOIFXNWTHPQ-VSJRJJFNSA-N |
| XLogP | 1.95 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.98 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|