C20H22FN3O3 — CID 171144541
1-[(3-fluorophenyl)methyl]-7-(2-methyl-1,3-oxazole-4-carbonyl)-4,5,5a,6,8,8a-hexahydro-3H-pyrrolo[3,4-b]azepin-2-one (PubChem CID 171144541) has the molecular formula C20H22FN3O3 and a molecular weight of 371.41 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-7-(2-methyl-1,3-oxazole-4-carbonyl)-4,5,5a,6,8,8a-hexahydro-3H-pyrrolo[3,4-b]azepin-2-one.
| Compound Name | 1-[(3-fluorophenyl)methyl]-7-(2-methyl-1,3-oxazole-4-carbonyl)-4,5,5a,6,8,8a-hexahydro-3H-pyrrolo[3,4-b]azepin-2-one |
|---|---|
| PubChem CID | 171144541 |
| Molecular Formula | C20H22FN3O3 |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-7-(2-methyl-1,3-oxazole-4-carbonyl)-4,5,5a,6,8,8a-hexahydro-3H-pyrrolo[3,4-b]azepin-2-one |
| SMILES | Cc1nc(C(=O)N2CC3CCCC(=O)N(Cc4cccc(F)c4)C3C2)co1 |
| InChI | InChI=1S/C20H22FN3O3/c1-13-22-17(12-27-13)20(26)23-10-15-5-3-7-19(25)24(18(15)11-23)9-14-4-2-6-16(21)8-14/h2,4,6,8,12,15,18H,3,5,7,9-11H2,1H3 |
| InChIKey | AQDXRAWXLDPFPJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |