C23H33N3O5S2 — CID 171152275
N,N-diethylethanamine;3-[2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-oxazolidin-5-ylidene)quinolin-1-yl]propane-1-sulfonic acid (PubChem CID 171152275) has the molecular formula C23H33N3O5S2 and a molecular weight of 495.67 g/mol. Its IUPAC name is N,N-diethylethanamine;3-[2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-oxazolidin-5-ylidene)quinolin-1-yl]propane-1-sulfonic acid.
| Compound Name | N,N-diethylethanamine;3-[2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-oxazolidin-5-ylidene)quinolin-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 171152275 |
| Molecular Formula | C23H33N3O5S2 |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | N,N-diethylethanamine;3-[2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-oxazolidin-5-ylidene)quinolin-1-yl]propane-1-sulfonic acid |
| SMILES | CCN(CC)CC.CCN1C(=O)C(=C2C=Cc3ccccc3N2CCCS(=O)(=O)O)OC1=S |
| InChI | InChI=1S/C17H18N2O5S2.C6H15N/c1-2-18-16(20)15(24-17(18)25)14-9-8-12-6-3-4-7-13(12)19(14)10-5-11-26(21,22)23;1-4-7(5-2)6-3/h3-4,6-9H,2,5,10-11H2,1H3,(H,21,22,23);4-6H2,1-3H3 |
| InChIKey | NGWCAYXSQHIRMP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_J(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|