C18H18N6O6 — CID 171158461
2-[3-azidopropyl-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]acetic acid (PubChem CID 171158461) has the molecular formula C18H18N6O6 and a molecular weight of 414.38 g/mol. Its IUPAC name is 2-[3-azidopropyl-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]acetic acid.
| Compound Name | 2-[3-azidopropyl-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]acetic acid |
|---|---|
| PubChem CID | 171158461 |
| Molecular Formula | C18H18N6O6 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 2-[3-azidopropyl-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]acetic acid |
| SMILES | [N-]=[N+]=NCCCN(CC(=O)O)c1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C18H18N6O6/c19-22-20-7-2-8-23(9-14(26)27)11-4-1-3-10-15(11)18(30)24(17(10)29)12-5-6-13(25)21-16(12)28/h1,3-4,12H,2,5-9H2,(H,26,27)(H,21,25,28) |
| InChIKey | GRUGIYRNLNZIAU-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 172.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|