C12H19ClN2O3 — CID 171231278
5-[(1S)-1,5-diaminopentyl]-2-hydroxybenzoic acid;hydrochloride (PubChem CID 171231278) has the molecular formula C12H19ClN2O3 and a molecular weight of 274.75 g/mol. Its IUPAC name is 5-[(1S)-1,5-diaminopentyl]-2-hydroxybenzoic acid;hydrochloride.
| Compound Name | 5-[(1S)-1,5-diaminopentyl]-2-hydroxybenzoic acid;hydrochloride |
|---|---|
| PubChem CID | 171231278 |
| Molecular Formula | C12H19ClN2O3 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 5-[(1S)-1,5-diaminopentyl]-2-hydroxybenzoic acid;hydrochloride |
| SMILES | Cl.NCCCC[C@H](N)c1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H18N2O3.ClH/c13-6-2-1-3-10(14)8-4-5-11(15)9(7-8)12(16)17;/h4-5,7,10,15H,1-3,6,13-14H2,(H,16,17);1H/t10-;/m0./s1 |
| InChIKey | KBFZQUMYZZMRRT-PPHPATTJSA-N |
| XLogP | 1.64 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|