C17H27N3O — CID 171289266
1-[(R)-cyclohexyl-(6-methoxy-3-pyridinyl)methyl]piperazine (PubChem CID 171289266) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is 1-[(R)-cyclohexyl-(6-methoxy-3-pyridinyl)methyl]piperazine.
| Compound Name | 1-[(R)-cyclohexyl-(6-methoxy-3-pyridinyl)methyl]piperazine |
|---|---|
| PubChem CID | 171289266 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | 1-[(R)-cyclohexyl-(6-methoxy-3-pyridinyl)methyl]piperazine |
| SMILES | COc1ccc([C@@H](C2CCCCC2)N2CCNCC2)cn1 |
| InChI | InChI=1S/C17H27N3O/c1-21-16-8-7-15(13-19-16)17(14-5-3-2-4-6-14)20-11-9-18-10-12-20/h7-8,13-14,17-18H,2-6,9-12H2,1H3/t17-/m1/s1 |
| InChIKey | RYGXMFYAXKVNFE-QGZVFWFLSA-N |
| XLogP | 2.62 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |