C10H9ClF5NO2 — CID 171311998
4-[(1S)-1-amino-2,2,3,3,3-pentafluoropropyl]-2-chloro-6-methoxyphenol (PubChem CID 171311998) has the molecular formula C10H9ClF5NO2 and a molecular weight of 305.63 g/mol. Its IUPAC name is 4-[(1S)-1-amino-2,2,3,3,3-pentafluoropropyl]-2-chloro-6-methoxyphenol.
| Compound Name | 4-[(1S)-1-amino-2,2,3,3,3-pentafluoropropyl]-2-chloro-6-methoxyphenol |
|---|---|
| PubChem CID | 171311998 |
| Molecular Formula | C10H9ClF5NO2 |
| Molecular Weight | 305.63 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 4-[(1S)-1-amino-2,2,3,3,3-pentafluoropropyl]-2-chloro-6-methoxyphenol |
| SMILES | COc1cc([C@H](N)C(F)(F)C(F)(F)F)cc(Cl)c1O |
| InChI | InChI=1S/C10H9ClF5NO2/c1-19-6-3-4(2-5(11)7(6)18)8(17)9(12,13)10(14,15)16/h2-3,8,18H,17H2,1H3/t8-/m0/s1 |
| InChIKey | JTEJCUHLKVEWIO-QMMMGPOBSA-N |
| XLogP | 3.25 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.63 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|