C21H31N5O5S — CID 171317559
formic acid;9-(1-methylimidazol-4-yl)sulfonyl-4-phenyl-1,5,9-triazacyclotridecan-2-one (PubChem CID 171317559) has the molecular formula C21H31N5O5S and a molecular weight of 465.58 g/mol. Its IUPAC name is formic acid;9-(1-methylimidazol-4-yl)sulfonyl-4-phenyl-1,5,9-triazacyclotridecan-2-one.
| Compound Name | formic acid;9-(1-methylimidazol-4-yl)sulfonyl-4-phenyl-1,5,9-triazacyclotridecan-2-one |
|---|---|
| PubChem CID | 171317559 |
| Molecular Formula | C21H31N5O5S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | formic acid;9-(1-methylimidazol-4-yl)sulfonyl-4-phenyl-1,5,9-triazacyclotridecan-2-one |
| SMILES | Cn1cnc(S(=O)(=O)N2CCCCNC(=O)CC(c3ccccc3)NCCC2)c1.O=CO |
| InChI | InChI=1S/C20H29N5O3S.CH2O2/c1-24-15-20(23-16-24)29(27,28)25-12-6-5-10-22-19(26)14-18(21-11-7-13-25)17-8-3-2-4-9-17;2-1-3/h2-4,8-9,15-16,18,21H,5-7,10-14H2,1H3,(H,22,26);1H,(H,2,3) |
| InChIKey | NOLRDQQCGMIUNL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 133.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|