C14H15F4N3O2 — CID 171327611
3-fluoro-1-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]pyrrolidine-3-carboxamide (PubChem CID 171327611) has the molecular formula C14H15F4N3O2 and a molecular weight of 333.29 g/mol. Its IUPAC name is 3-fluoro-1-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]pyrrolidine-3-carboxamide.
| Compound Name | 3-fluoro-1-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 171327611 |
| Molecular Formula | C14H15F4N3O2 |
| Molecular Weight | 333.29 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 3-fluoro-1-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]pyrrolidine-3-carboxamide |
| SMILES | NC(=O)C1(F)CCN(CC(=O)Nc2ccccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C14H15F4N3O2/c15-13(12(19)23)5-6-21(8-13)7-11(22)20-10-4-2-1-3-9(10)14(16,17)18/h1-4H,5-8H2,(H2,19,23)(H,20,22) |
| InChIKey | ZFFNPARUUZKAKO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |