C25H30N6O2 — CID 171329127
N-benzyl-4-[5-(1-morpholin-4-ylcyclohexyl)tetrazol-1-yl]benzamide (PubChem CID 171329127) has the molecular formula C25H30N6O2 and a molecular weight of 446.56 g/mol. Its IUPAC name is N-benzyl-4-[5-(1-morpholin-4-ylcyclohexyl)tetrazol-1-yl]benzamide.
| Compound Name | N-benzyl-4-[5-(1-morpholin-4-ylcyclohexyl)tetrazol-1-yl]benzamide |
|---|---|
| PubChem CID | 171329127 |
| Molecular Formula | C25H30N6O2 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | N-benzyl-4-[5-(1-morpholin-4-ylcyclohexyl)tetrazol-1-yl]benzamide |
| SMILES | O=C(NCc1ccccc1)c1ccc(-n2nnnc2C2(N3CCOCC3)CCCCC2)cc1 |
| InChI | InChI=1S/C25H30N6O2/c32-23(26-19-20-7-3-1-4-8-20)21-9-11-22(12-10-21)31-24(27-28-29-31)25(13-5-2-6-14-25)30-15-17-33-18-16-30/h1,3-4,7-12H,2,5-6,13-19H2,(H,26,32) |
| InChIKey | AORRJLPGXQAOAD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |