C32H30N6O6 — CID 171346540
2-(2,6-dioxopiperidin-3-yl)-4-[2-[6-methoxy-4-[[(1R)-1-phenylethyl]amino]quinazolin-7-yl]oxyethylamino]isoindole-1,3-dione (PubChem CID 171346540) has the molecular formula C32H30N6O6 and a molecular weight of 594.63 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[2-[6-methoxy-4-[[(1R)-1-phenylethyl]amino]quinazolin-7-yl]oxyethylamino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[2-[6-methoxy-4-[[(1R)-1-phenylethyl]amino]quinazolin-7-yl]oxyethylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 171346540 |
| Molecular Formula | C32H30N6O6 |
| Molecular Weight | 594.63 g/mol |
| Exact Mass | 594.22 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[2-[6-methoxy-4-[[(1R)-1-phenylethyl]amino]quinazolin-7-yl]oxyethylamino]isoindole-1,3-dione |
| SMILES | COc1cc2c(N[C@H](C)c3ccccc3)ncnc2cc1OCCNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C32H30N6O6/c1-18(19-7-4-3-5-8-19)36-29-21-15-25(43-2)26(16-23(21)34-17-35-29)44-14-13-33-22-10-6-9-20-28(22)32(42)38(31(20)41)24-11-12-27(39)37-30(24)40/h3-10,15-18,24,33H,11-14H2,1-2H3,(H,34,35,36)(H,37,39,40)/t18-,24?/m1/s1 |
| InChIKey | HWDCUEJLLWWYNV-QFADGXAASA-N |
| XLogP | 3.70 |
| TPSA | 151.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.63 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|