C27H30N4O6 — CID 166059917
N-[(1S)-1-[4-[4-[[2-[(3S)-2,6-dioxopiperidin-3-yl]-1,3-dioxoisoindol-4-yl]amino]butoxy]phenyl]ethyl]acetamide (PubChem CID 166059917) has the molecular formula C27H30N4O6 and a molecular weight of 506.56 g/mol. Its IUPAC name is N-[(1S)-1-[4-[4-[[2-[(3S)-2,6-dioxopiperidin-3-yl]-1,3-dioxoisoindol-4-yl]amino]butoxy]phenyl]ethyl]acetamide.
| Compound Name | N-[(1S)-1-[4-[4-[[2-[(3S)-2,6-dioxopiperidin-3-yl]-1,3-dioxoisoindol-4-yl]amino]butoxy]phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 166059917 |
| Molecular Formula | C27H30N4O6 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | N-[(1S)-1-[4-[4-[[2-[(3S)-2,6-dioxopiperidin-3-yl]-1,3-dioxoisoindol-4-yl]amino]butoxy]phenyl]ethyl]acetamide |
| SMILES | CC(=O)N[C@@H](C)c1ccc(OCCCCNc2cccc3c2C(=O)N([C@H]2CCC(=O)NC2=O)C3=O)cc1 |
| InChI | InChI=1S/C27H30N4O6/c1-16(29-17(2)32)18-8-10-19(11-9-18)37-15-4-3-14-28-21-7-5-6-20-24(21)27(36)31(26(20)35)22-12-13-23(33)30-25(22)34/h5-11,16,22,28H,3-4,12-15H2,1-2H3,(H,29,32)(H,30,33,34)/t16-,22-/m0/s1 |
| InChIKey | PSFOBNPZVNQIRA-AOMKIAJQSA-N |
| XLogP | 2.56 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|