C23H31N5O2 — CID 171348479
2-[8-(3-methoxypropyl)-8-azabicyclo[3.2.1]octan-3-yl]-5-(1-propan-2-ylindazol-3-yl)-1,3,4-oxadiazole (PubChem CID 171348479) has the molecular formula C23H31N5O2 and a molecular weight of 409.53 g/mol. Its IUPAC name is 2-[8-(3-methoxypropyl)-8-azabicyclo[3.2.1]octan-3-yl]-5-(1-propan-2-ylindazol-3-yl)-1,3,4-oxadiazole.
| Compound Name | 2-[8-(3-methoxypropyl)-8-azabicyclo[3.2.1]octan-3-yl]-5-(1-propan-2-ylindazol-3-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 171348479 |
| Molecular Formula | C23H31N5O2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | 2-[8-(3-methoxypropyl)-8-azabicyclo[3.2.1]octan-3-yl]-5-(1-propan-2-ylindazol-3-yl)-1,3,4-oxadiazole |
| SMILES | COCCCN1C2CCC1CC(c1nnc(-c3nn(C(C)C)c4ccccc34)o1)C2 |
| InChI | InChI=1S/C23H31N5O2/c1-15(2)28-20-8-5-4-7-19(20)21(26-28)23-25-24-22(30-23)16-13-17-9-10-18(14-16)27(17)11-6-12-29-3/h4-5,7-8,15-18H,6,9-14H2,1-3H3 |
| InChIKey | NRVIZHOWSWLONR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 69.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|