C24H33N5O6 — CID 171344196
2-methyl-4-[4-[5-(1-propan-2-ylindazol-3-yl)-1,3,4-oxadiazol-2-yl]piperidin-1-yl]butan-2-ol;oxalic acid (PubChem CID 171344196) has the molecular formula C24H33N5O6 and a molecular weight of 487.56 g/mol. Its IUPAC name is 2-methyl-4-[4-[5-(1-propan-2-ylindazol-3-yl)-1,3,4-oxadiazol-2-yl]piperidin-1-yl]butan-2-ol;oxalic acid.
| Compound Name | 2-methyl-4-[4-[5-(1-propan-2-ylindazol-3-yl)-1,3,4-oxadiazol-2-yl]piperidin-1-yl]butan-2-ol;oxalic acid |
|---|---|
| PubChem CID | 171344196 |
| Molecular Formula | C24H33N5O6 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | 2-methyl-4-[4-[5-(1-propan-2-ylindazol-3-yl)-1,3,4-oxadiazol-2-yl]piperidin-1-yl]butan-2-ol;oxalic acid |
| SMILES | CC(C)n1nc(-c2nnc(C3CCN(CCC(C)(C)O)CC3)o2)c2ccccc21.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H31N5O2.C2H2O4/c1-15(2)27-18-8-6-5-7-17(18)19(25-27)21-24-23-20(29-21)16-9-12-26(13-10-16)14-11-22(3,4)28;3-1(4)2(5)6/h5-8,15-16,28H,9-14H2,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | QZQBGNSOHKJTFF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 154.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|