C20H17FN6O3S2 — CID 171357867
2-[4,5-dimethyl-1-(4-nitroanilino)imidazol-2-yl]sulfanyl-N-(6-fluoro-1,3-benzothiazol-2-yl)acetamide (PubChem CID 171357867) has the molecular formula C20H17FN6O3S2 and a molecular weight of 472.53 g/mol. Its IUPAC name is 2-[4,5-dimethyl-1-(4-nitroanilino)imidazol-2-yl]sulfanyl-N-(6-fluoro-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-[4,5-dimethyl-1-(4-nitroanilino)imidazol-2-yl]sulfanyl-N-(6-fluoro-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 171357867 |
| Molecular Formula | C20H17FN6O3S2 |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | 2-[4,5-dimethyl-1-(4-nitroanilino)imidazol-2-yl]sulfanyl-N-(6-fluoro-1,3-benzothiazol-2-yl)acetamide |
| SMILES | Cc1nc(SCC(=O)Nc2nc3ccc(F)cc3s2)n(Nc2ccc([N+](=O)[O-])cc2)c1C |
| InChI | InChI=1S/C20H17FN6O3S2/c1-11-12(2)26(25-14-4-6-15(7-5-14)27(29)30)20(22-11)31-10-18(28)24-19-23-16-8-3-13(21)9-17(16)32-19/h3-9,25H,10H2,1-2H3,(H,23,24,28) |
| InChIKey | BKFPCMRBGJLABJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|