C30H42N6O2 — CID 171362939
2-[2-[(E)-3-methoxyprop-2-enoyl]-2,7-diazaspiro[3.4]octan-7-yl]-7,7-dimethyl-4-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-4-yl)-6,8-dihydro-5H-quinoline-3-carbonitrile (PubChem CID 171362939) has the molecular formula C30H42N6O2 and a molecular weight of 518.71 g/mol. Its IUPAC name is 2-[2-[(E)-3-methoxyprop-2-enoyl]-2,7-diazaspiro[3.4]octan-7-yl]-7,7-dimethyl-4-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-4-yl)-6,8-dihydro-5H-quinoline-3-carbonitrile.
| Compound Name | 2-[2-[(E)-3-methoxyprop-2-enoyl]-2,7-diazaspiro[3.4]octan-7-yl]-7,7-dimethyl-4-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-4-yl)-6,8-dihydro-5H-quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 171362939 |
| Molecular Formula | C30H42N6O2 |
| Molecular Weight | 518.71 g/mol |
| Exact Mass | 518.34 |
| IUPAC Name | 2-[2-[(E)-3-methoxyprop-2-enoyl]-2,7-diazaspiro[3.4]octan-7-yl]-7,7-dimethyl-4-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-4-yl)-6,8-dihydro-5H-quinoline-3-carbonitrile |
| SMILES | CO/C=C/C(=O)N1CC2(CCN(c3nc4c(c(C5C(C)CCC6NNCC65)c3C#N)CCC(C)(C)C4)C2)C1 |
| InChI | InChI=1S/C30H42N6O2/c1-19-5-6-23-22(15-32-34-23)26(19)27-20-7-9-29(2,3)13-24(20)33-28(21(27)14-31)35-11-10-30(16-35)17-36(18-30)25(37)8-12-38-4/h8,12,19,22-23,26,32,34H,5-7,9-11,13,15-18H2,1-4H3/b12-8+ |
| InChIKey | OHBWWHHRQDDDCW-XYOKQWHBSA-N |
| XLogP | 3.27 |
| TPSA | 93.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.71 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|