C23H28F3N3O2 — CID 171364174
(1S)-N-[3-(trifluoromethoxy)phenyl]-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carboxamide (PubChem CID 171364174) has the molecular formula C23H28F3N3O2 and a molecular weight of 435.49 g/mol. Its IUPAC name is (1S)-N-[3-(trifluoromethoxy)phenyl]-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carboxamide.
| Compound Name | (1S)-N-[3-(trifluoromethoxy)phenyl]-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carboxamide |
|---|---|
| PubChem CID | 171364174 |
| Molecular Formula | C23H28F3N3O2 |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | (1S)-N-[3-(trifluoromethoxy)phenyl]-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene-3-carboxamide |
| SMILES | O=C(Nc1cccc(OC(F)(F)F)c1)N1CCCC2=CC3C[C@@H](CN4CCCCC34)C21 |
| InChI | InChI=1S/C23H28F3N3O2/c24-23(25,26)31-19-7-3-6-18(13-19)27-22(30)29-10-4-5-15-11-16-12-17(21(15)29)14-28-9-2-1-8-20(16)28/h3,6-7,11,13,16-17,20-21H,1-2,4-5,8-10,12,14H2,(H,27,30)/t16?,17-,20?,21?/m0/s1 |
| InChIKey | RGMOWKMCHFVBQH-MXTKIGNMSA-N |
| XLogP | 5.01 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|