C29H40F3N3O2 — CID 127051049
N-[5-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]pentyl]-2-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 127051049) has the molecular formula C29H40F3N3O2 and a molecular weight of 519.65 g/mol. Its IUPAC name is N-[5-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]pentyl]-2-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | N-[5-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]pentyl]-2-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 127051049 |
| Molecular Formula | C29H40F3N3O2 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.31 |
| IUPAC Name | N-[5-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]pentyl]-2-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | O=C(Cc1ccc(OC(F)(F)F)cc1)NCCCCCN1CCCC2=C[C@H]3C[C@H](CN4CCCC[C@H]34)[C@@H]21 |
| InChI | InChI=1S/C29H40F3N3O2/c30-29(31,32)37-25-11-9-21(10-12-25)17-27(36)33-13-3-1-4-14-34-16-6-7-22-18-23-19-24(28(22)34)20-35-15-5-2-8-26(23)35/h9-12,18,23-24,26,28H,1-8,13-17,19-20H2,(H,33,36)/t23-,24+,26+,28+/m0/s1 |
| InChIKey | MGNDUAVIKQXEDX-ONRXEWETSA-N |
| XLogP | 5.31 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|