C27H35F4N3O — CID 134816035
N-[4-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]butyl]-3-fluoro-4-(trifluoromethyl)benzamide (PubChem CID 134816035) has the molecular formula C27H35F4N3O and a molecular weight of 493.59 g/mol. Its IUPAC name is N-[4-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]butyl]-3-fluoro-4-(trifluoromethyl)benzamide.
| Compound Name | N-[4-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]butyl]-3-fluoro-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 134816035 |
| Molecular Formula | C27H35F4N3O |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | N-[4-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]butyl]-3-fluoro-4-(trifluoromethyl)benzamide |
| SMILES | O=C(NCCCCN1CCCC2=C[C@H]3C[C@H](CN4CCCC[C@H]34)[C@@H]21)c1ccc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C27H35F4N3O/c28-23-16-19(8-9-22(23)27(29,30)31)26(35)32-10-2-4-11-33-13-5-6-18-14-20-15-21(25(18)33)17-34-12-3-1-7-24(20)34/h8-9,14,16,20-21,24-25H,1-7,10-13,15,17H2,(H,32,35)/t20-,21+,24+,25+/m0/s1 |
| InChIKey | DEHMDMVVAXIPPZ-ZNDGRNAPSA-N |
| XLogP | 5.25 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|