C6H5Cl2FN2O2S — CID 171367534
2,6-dichloro-4-fluorobenzenesulfonohydrazide (PubChem CID 171367534) has the molecular formula C6H5Cl2FN2O2S and a molecular weight of 259.09 g/mol. Its IUPAC name is 2,6-dichloro-4-fluorobenzenesulfonohydrazide.
| Compound Name | 2,6-dichloro-4-fluorobenzenesulfonohydrazide |
|---|---|
| PubChem CID | 171367534 |
| Molecular Formula | C6H5Cl2FN2O2S |
| Molecular Weight | 259.09 g/mol |
| Exact Mass | 257.94 |
| IUPAC Name | 2,6-dichloro-4-fluorobenzenesulfonohydrazide |
| SMILES | NNS(=O)(=O)c1c(Cl)cc(F)cc1Cl |
| InChI | InChI=1S/C6H5Cl2FN2O2S/c7-4-1-3(9)2-5(8)6(4)14(12,13)11-10/h1-2,11H,10H2 |
| InChIKey | DDFDSVMBNAGCAA-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.09 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|