C11H13N3 — CID 171374870
1,2,3-trimethylquinoxalin-5-imine (PubChem CID 171374870) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is 1,2,3-trimethylquinoxalin-5-imine.
| Compound Name | 1,2,3-trimethylquinoxalin-5-imine |
|---|---|
| PubChem CID | 171374870 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 1,2,3-trimethylquinoxalin-5-imine |
| SMILES | [H]/N=c1\cccc2n(C)c(C)c(C)nc1-2 |
| InChI | InChI=1S/C11H13N3/c1-7-8(2)14(3)10-6-4-5-9(12)11(10)13-7/h4-6,12H,1-3H3/b12-9+ |
| InChIKey | MFYOGMLOVPFSNH-FMIVXFBMSA-N |
| XLogP | 1.62 |
| TPSA | 41.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |